C63H55NO6 — CID 58590228
[4-[1-[4-[4-[2-[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate (PubChem CID 58590228) has the molecular formula C63H55NO6 and a molecular weight of 922.13 g/mol. Its IUPAC name is [4-[1-[4-[4-[2-[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-[4-[4-[2-[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 58590228 |
| Molecular Formula | C63H55NO6 |
| Molecular Weight | 922.13 g/mol |
| Exact Mass | 921.40 |
| IUPAC Name | [4-[1-[4-[4-[2-[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
| SMILES | COc1ccc(C(=Cc2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c2ccc(OC(=O)Oc3ccc(C4(c5ccc(OC(C)=O)cc5)CCCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C63H55NO6/c1-43(65)68-53-34-23-47(24-35-53)63(39-11-6-12-40-63)48-25-36-55(37-26-48)70-61(66)69-54-32-21-46(22-33-54)58(45-19-30-52(67-4)31-20-45)41-44-17-27-50(28-18-44)64(49-13-7-5-8-14-49)51-29-38-57-56-15-9-10-16-59(56)62(2,3)60(57)42-51/h5,7-10,13-38,41-42H,6,11-12,39-40H2,1-4H3 |
| InChIKey | AUDNLLXOILTOKB-UHFFFAOYSA-N |
| XLogP | 15.81 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.13 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|