C43H37NO4 — CID 59899796
[4-[4-(2-ethenoxyethyl)-N-[10-[2-(4-ethoxyphenyl)ethenyl]anthracen-9-yl]anilino]phenyl] prop-2-enoate (PubChem CID 59899796) has the molecular formula C43H37NO4 and a molecular weight of 631.77 g/mol. Its IUPAC name is [4-[4-(2-ethenoxyethyl)-N-[10-[2-(4-ethoxyphenyl)ethenyl]anthracen-9-yl]anilino]phenyl] prop-2-enoate.
| Compound Name | [4-[4-(2-ethenoxyethyl)-N-[10-[2-(4-ethoxyphenyl)ethenyl]anthracen-9-yl]anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59899796 |
| Molecular Formula | C43H37NO4 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | [4-[4-(2-ethenoxyethyl)-N-[10-[2-(4-ethoxyphenyl)ethenyl]anthracen-9-yl]anilino]phenyl] prop-2-enoate |
| SMILES | C=COCCc1ccc(N(c2ccc(OC(=O)C=C)cc2)c2c3ccccc3c(C=Cc3ccc(OCC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H37NO4/c1-4-42(45)48-36-26-22-34(23-27-36)44(33-20-15-32(16-21-33)29-30-46-5-2)43-40-13-9-7-11-37(40)39(38-12-8-10-14-41(38)43)28-19-31-17-24-35(25-18-31)47-6-3/h4-5,7-28H,1-2,6,29-30H2,3H3 |
| InChIKey | GYQVGDVVBJTFRH-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|