C24H26O6 — CID 70639945
1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 4-cyclohexa-1,3-dien-1-ylbenzoate (PubChem CID 70639945) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 4-cyclohexa-1,3-dien-1-ylbenzoate.
| Compound Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 4-cyclohexa-1,3-dien-1-ylbenzoate |
|---|---|
| PubChem CID | 70639945 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 4-cyclohexa-1,3-dien-1-ylbenzoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)OC(=O)c1ccc(C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C24H26O6/c1-16(2)22(25)28-14-21(15-29-23(26)17(3)4)30-24(27)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h5-6,8,10-13,21H,1,3,7,9,14-15H2,2,4H3 |
| InChIKey | KZRNVOGHIRCQLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|