C22H28O4 — CID 89268647
[1-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate (PubChem CID 89268647) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [1-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89268647 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [1-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=CCOCC(COC1=CC=C(C2=CC=CCC2)CC1)OC(=O)C(=C)C |
| InChI | InChI=1S/C22H28O4/c1-4-14-24-15-21(26-22(23)17(2)3)16-25-20-12-10-19(11-13-20)18-8-6-5-7-9-18/h4-6,8,10,12,21H,1-2,7,9,11,13-16H2,3H3 |
| InChIKey | USHMWPDAHZMZEZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|