C35H34O12S2 — CID 176734652
1-O-[2-[2-[4-[(4-methylbenzoyl)oxymethylsulfanylmethoxycarbonyl]benzoyl]oxyethylsulfanyl]ethyl] 4-O-(2-methylprop-2-enoyloxymethyl) benzene-1,4-dicarboxylate (PubChem CID 176734652) has the molecular formula C35H34O12S2 and a molecular weight of 710.78 g/mol. Its IUPAC name is 1-O-[2-[2-[4-[(4-methylbenzoyl)oxymethylsulfanylmethoxycarbonyl]benzoyl]oxyethylsulfanyl]ethyl] 4-O-(2-methylprop-2-enoyloxymethyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[2-[2-[4-[(4-methylbenzoyl)oxymethylsulfanylmethoxycarbonyl]benzoyl]oxyethylsulfanyl]ethyl] 4-O-(2-methylprop-2-enoyloxymethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176734652 |
| Molecular Formula | C35H34O12S2 |
| Molecular Weight | 710.78 g/mol |
| Exact Mass | 710.15 |
| IUPAC Name | 1-O-[2-[2-[4-[(4-methylbenzoyl)oxymethylsulfanylmethoxycarbonyl]benzoyl]oxyethylsulfanyl]ethyl] 4-O-(2-methylprop-2-enoyloxymethyl) benzene-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCOC(=O)c1ccc(C(=O)OCCSCCOC(=O)c2ccc(C(=O)OCSCOC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H34O12S2/c1-23(2)30(36)44-20-45-33(39)28-12-8-26(9-13-28)31(37)42-16-18-48-19-17-43-32(38)27-10-14-29(15-11-27)35(41)47-22-49-21-46-34(40)25-6-4-24(3)5-7-25/h4-15H,1,16-22H2,2-3H3 |
| InChIKey | RZZAJPXOJDRHDO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|