C22H35NO3 — CID 91737153
4-methylpentyl 3-[bis(2-methylpropyl)carbamoyl]benzoate (PubChem CID 91737153) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 4-methylpentyl 3-[bis(2-methylpropyl)carbamoyl]benzoate.
| Compound Name | 4-methylpentyl 3-[bis(2-methylpropyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 91737153 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 4-methylpentyl 3-[bis(2-methylpropyl)carbamoyl]benzoate |
| SMILES | CC(C)CCCOC(=O)c1cccc(C(=O)N(CC(C)C)CC(C)C)c1 |
| InChI | InChI=1S/C22H35NO3/c1-16(2)9-8-12-26-22(25)20-11-7-10-19(13-20)21(24)23(14-17(3)4)15-18(5)6/h7,10-11,13,16-18H,8-9,12,14-15H2,1-6H3 |
| InChIKey | INOODSYHEDROCB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|