C20H30O4 — CID 91737143
3-O-hexan-2-yl 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate (PubChem CID 91737143) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-O-hexan-2-yl 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate.
| Compound Name | 3-O-hexan-2-yl 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91737143 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-O-hexan-2-yl 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate |
| SMILES | CCCCC(C)OC(=O)c1cccc(C(=O)OCCCC(C)C)c1 |
| InChI | InChI=1S/C20H30O4/c1-5-6-10-16(4)24-20(22)18-12-7-11-17(14-18)19(21)23-13-8-9-15(2)3/h7,11-12,14-16H,5-6,8-10,13H2,1-4H3 |
| InChIKey | CUYLNOPOKBLBIJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|