C12H12O2 — CID 15568424
(E)-1-phenylhex-3-ene-1,5-dione (PubChem CID 15568424) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (E)-1-phenylhex-3-ene-1,5-dione.
| Compound Name | (E)-1-phenylhex-3-ene-1,5-dione |
|---|---|
| PubChem CID | 15568424 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (E)-1-phenylhex-3-ene-1,5-dione |
| SMILES | CC(=O)/C=C/CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-10(13)6-5-9-12(14)11-7-3-2-4-8-11/h2-8H,9H2,1H3/b6-5+ |
| InChIKey | DFXFHTQYDFFJDE-AATRIKPKSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|