C43H20F4N6 — CID 165033046
4-[2-[2-(4-cyanophenyl)-3-(4-isocyanophenyl)-6-methylpyrazino[2,3-k]phenanthridin-7-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 165033046) has the molecular formula C43H20F4N6 and a molecular weight of 696.67 g/mol. Its IUPAC name is 4-[2-[2-(4-cyanophenyl)-3-(4-isocyanophenyl)-6-methylpyrazino[2,3-k]phenanthridin-7-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[2-[2-(4-cyanophenyl)-3-(4-isocyanophenyl)-6-methylpyrazino[2,3-k]phenanthridin-7-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 165033046 |
| Molecular Formula | C43H20F4N6 |
| Molecular Weight | 696.67 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 4-[2-[2-(4-cyanophenyl)-3-(4-isocyanophenyl)-6-methylpyrazino[2,3-k]phenanthridin-7-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc(C)c4c(-c5ccccc5-c5c(F)c(F)c(C#N)c(F)c5F)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C43H20F4N6/c1-22-19-32-43(53-41(24-13-11-23(20-48)12-14-24)40(52-32)25-15-17-26(50-2)18-16-25)34-29-9-5-6-10-31(29)51-42(33(22)34)28-8-4-3-7-27(28)35-38(46)36(44)30(21-49)37(45)39(35)47/h3-19H,1H3 |
| InChIKey | PZEYOBMPFICCMK-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.67 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|