C42H32BN5O2 — CID 165016760
4-[3-(4-isocyanophenyl)-6-methyl-7-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile (PubChem CID 165016760) has the molecular formula C42H32BN5O2 and a molecular weight of 649.56 g/mol. Its IUPAC name is 4-[3-(4-isocyanophenyl)-6-methyl-7-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile.
| Compound Name | 4-[3-(4-isocyanophenyl)-6-methyl-7-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 165016760 |
| Molecular Formula | C42H32BN5O2 |
| Molecular Weight | 649.56 g/mol |
| Exact Mass | 649.26 |
| IUPAC Name | 4-[3-(4-isocyanophenyl)-6-methyl-7-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc(C)c4c(-c5cccc(B6OC(C)(C)C(C)(C)O6)c5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C42H32BN5O2/c1-25-22-34-40(48-39(27-16-14-26(24-44)15-17-27)38(47-34)28-18-20-31(45-6)21-19-28)36-32-12-7-8-13-33(32)46-37(35(25)36)29-10-9-11-30(23-29)43-49-41(2,3)42(4,5)50-43/h7-23H,1-5H3 |
| InChIKey | KNSSCXYWDWTRLS-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.56 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|