C32H28N2 — CID 118103502
2,3-bis(3,5-dimethylphenyl)-5-(4-phenylphenyl)pyrazine (PubChem CID 118103502) has the molecular formula C32H28N2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2,3-bis(3,5-dimethylphenyl)-5-(4-phenylphenyl)pyrazine.
| Compound Name | 2,3-bis(3,5-dimethylphenyl)-5-(4-phenylphenyl)pyrazine |
|---|---|
| PubChem CID | 118103502 |
| Molecular Formula | C32H28N2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2,3-bis(3,5-dimethylphenyl)-5-(4-phenylphenyl)pyrazine |
| SMILES | Cc1cc(C)cc(-c2ncc(-c3ccc(-c4ccccc4)cc3)nc2-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C32H28N2/c1-21-14-22(2)17-28(16-21)31-32(29-18-23(3)15-24(4)19-29)34-30(20-33-31)27-12-10-26(11-13-27)25-8-6-5-7-9-25/h5-20H,1-4H3 |
| InChIKey | YQDMNQRUEVOKKM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |