C15H8F6O3 — CID 118831979
5-[2-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 118831979) has the molecular formula C15H8F6O3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 5-[2-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-[2-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 118831979 |
| Molecular Formula | C15H8F6O3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-[2-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2OC(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H8F6O3/c16-14(17,18)11-6-5-8(7-10(11)13(22)23)9-3-1-2-4-12(9)24-15(19,20)21/h1-7H,(H,22,23) |
| InChIKey | PROVRXGJHHWJDX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |