C27H33NO8S — CID 69309320
ethyl 9-oxo-8-[4-(phenylmethoxycarbonylsulfamoyl)benzoyl]decanoate (PubChem CID 69309320) has the molecular formula C27H33NO8S and a molecular weight of 531.63 g/mol. Its IUPAC name is ethyl 9-oxo-8-[4-(phenylmethoxycarbonylsulfamoyl)benzoyl]decanoate.
| Compound Name | ethyl 9-oxo-8-[4-(phenylmethoxycarbonylsulfamoyl)benzoyl]decanoate |
|---|---|
| PubChem CID | 69309320 |
| Molecular Formula | C27H33NO8S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | ethyl 9-oxo-8-[4-(phenylmethoxycarbonylsulfamoyl)benzoyl]decanoate |
| SMILES | CCOC(=O)CCCCCCC(C(C)=O)C(=O)c1ccc(S(=O)(=O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H33NO8S/c1-3-35-25(30)14-10-5-4-9-13-24(20(2)29)26(31)22-15-17-23(18-16-22)37(33,34)28-27(32)36-19-21-11-7-6-8-12-21/h6-8,11-12,15-18,24H,3-5,9-10,13-14,19H2,1-2H3,(H,28,32) |
| InChIKey | YATVROXQYUXIMV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|