C16H17BNO5S — CID 67966725
CID 67966725 (PubChem CID 67966725) has the molecular formula C16H17BNO5S and a molecular weight of 346.19 g/mol.
| Compound Name | CID 67966725 |
|---|---|
| PubChem CID | 67966725 |
| Molecular Formula | C16H17BNO5S |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | — |
| SMILES | CC[B]Oc1ccc(S(=O)(=O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17BNO5S/c1-2-17-23-14-8-10-15(11-9-14)24(20,21)18-16(19)22-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3,(H,18,19) |
| InChIKey | NBOPMRLNHKEOEI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|