C16H12Br2O — CID 6062603
(E)-1,3-bis(4-bromophenyl)but-2-en-1-one (PubChem CID 6062603) has the molecular formula C16H12Br2O and a molecular weight of 380.08 g/mol. Its IUPAC name is (E)-1,3-bis(4-bromophenyl)but-2-en-1-one.
| Compound Name | (E)-1,3-bis(4-bromophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 6062603 |
| Molecular Formula | C16H12Br2O |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | (E)-1,3-bis(4-bromophenyl)but-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12Br2O/c1-11(12-2-6-14(17)7-3-12)10-16(19)13-4-8-15(18)9-5-13/h2-10H,1H3/b11-10+ |
| InChIKey | FVDBJBSKAOZMFT-ZHACJKMWSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|