C14H17Br — CID 145067539
1-bromo-4-[(2E,4Z)-4-methylhepta-2,4-dien-2-yl]benzene (PubChem CID 145067539) has the molecular formula C14H17Br and a molecular weight of 265.19 g/mol. Its IUPAC name is 1-bromo-4-[(2E,4Z)-4-methylhepta-2,4-dien-2-yl]benzene.
| Compound Name | 1-bromo-4-[(2E,4Z)-4-methylhepta-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 145067539 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-bromo-4-[(2E,4Z)-4-methylhepta-2,4-dien-2-yl]benzene |
| SMILES | CC/C=C(C)\C=C(/C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17Br/c1-4-5-11(2)10-12(3)13-6-8-14(15)9-7-13/h5-10H,4H2,1-3H3/b11-5-,12-10+ |
| InChIKey | ZYYWNGPAUFNPPC-KPMVHUKVSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|