C23H17Br2NO2 — CID 11237338
(Z)-1,4-bis(4-bromophenyl)-2-(4-methylanilino)but-2-ene-1,4-dione (PubChem CID 11237338) has the molecular formula C23H17Br2NO2 and a molecular weight of 499.20 g/mol. Its IUPAC name is (Z)-1,4-bis(4-bromophenyl)-2-(4-methylanilino)but-2-ene-1,4-dione.
| Compound Name | (Z)-1,4-bis(4-bromophenyl)-2-(4-methylanilino)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 11237338 |
| Molecular Formula | C23H17Br2NO2 |
| Molecular Weight | 499.20 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | (Z)-1,4-bis(4-bromophenyl)-2-(4-methylanilino)but-2-ene-1,4-dione |
| SMILES | Cc1ccc(N/C(=C\C(=O)c2ccc(Br)cc2)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H17Br2NO2/c1-15-2-12-20(13-3-15)26-21(23(28)17-6-10-19(25)11-7-17)14-22(27)16-4-8-18(24)9-5-16/h2-14,26H,1H3/b21-14- |
| InChIKey | FYFZRQFZJANHSA-STZFKDTASA-N |
| XLogP | 6.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.20 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|