C15H15F3O4 — CID 67696259
ethyl (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 67696259) has the molecular formula C15H15F3O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is ethyl (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 67696259 |
| Molecular Formula | C15H15F3O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | ethyl (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(/c1cccc(C2OCCO2)c1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O4/c1-2-20-13(19)9-12(15(16,17)18)10-4-3-5-11(8-10)14-21-6-7-22-14/h3-5,8-9,14H,2,6-7H2,1H3/b12-9- |
| InChIKey | VTUWKUWABUEWLK-XFXZXTDPSA-N |
| XLogP | 3.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|