C16H11F3O3 — CID 24726696
[3-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 24726696) has the molecular formula C16H11F3O3 and a molecular weight of 308.26 g/mol. Its IUPAC name is [3-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [3-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 24726696 |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [3-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cccc(C2OCCO2)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H11F3O3/c17-12-7-11(8-13(18)14(12)19)15(20)9-2-1-3-10(6-9)16-21-4-5-22-16/h1-3,6-8,16H,4-5H2 |
| InChIKey | JMRRXKDNTHIGQU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|