C16H19NO5 — CID 97246711
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(1,3-dioxolan-2-yl)benzoate (PubChem CID 97246711) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(1,3-dioxolan-2-yl)benzoate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(1,3-dioxolan-2-yl)benzoate |
|---|---|
| PubChem CID | 97246711 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(1,3-dioxolan-2-yl)benzoate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C16H19NO5/c1-3-7-17-14(18)11(2)22-15(19)12-5-4-6-13(10-12)16-20-8-9-21-16/h3-6,10-11,16H,1,7-9H2,2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | OMNFLIPSBJYZBI-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|