C11H15F3O4 — CID 102318867
ethyl (Z)-3-(1,3-dioxan-2-ylmethyl)-4,4,4-trifluorobut-2-enoate (PubChem CID 102318867) has the molecular formula C11H15F3O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is ethyl (Z)-3-(1,3-dioxan-2-ylmethyl)-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (Z)-3-(1,3-dioxan-2-ylmethyl)-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 102318867 |
| Molecular Formula | C11H15F3O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl (Z)-3-(1,3-dioxan-2-ylmethyl)-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(/CC1OCCCO1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O4/c1-2-16-9(15)6-8(11(12,13)14)7-10-17-4-3-5-18-10/h6,10H,2-5,7H2,1H3/b8-6- |
| InChIKey | ABVPPKSYTJDRMS-VURMDHGXSA-N |
| XLogP | 2.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|