C15H17ClF2O4 — CID 10958589
ethyl (Z)-5-(4-chlorophenyl)-3-ethoxy-4,4-difluoro-5-hydroxypent-2-enoate (PubChem CID 10958589) has the molecular formula C15H17ClF2O4 and a molecular weight of 334.75 g/mol. Its IUPAC name is ethyl (Z)-5-(4-chlorophenyl)-3-ethoxy-4,4-difluoro-5-hydroxypent-2-enoate.
| Compound Name | ethyl (Z)-5-(4-chlorophenyl)-3-ethoxy-4,4-difluoro-5-hydroxypent-2-enoate |
|---|---|
| PubChem CID | 10958589 |
| Molecular Formula | C15H17ClF2O4 |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | ethyl (Z)-5-(4-chlorophenyl)-3-ethoxy-4,4-difluoro-5-hydroxypent-2-enoate |
| SMILES | CCOC(=O)/C=C(\OCC)C(F)(F)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClF2O4/c1-3-21-12(9-13(19)22-4-2)15(17,18)14(20)10-5-7-11(16)8-6-10/h5-9,14,20H,3-4H2,1-2H3/b12-9- |
| InChIKey | RDIKOOLIKYOTOU-XFXZXTDPSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|