C14H14F3NO3 — CID 102519384
but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate (PubChem CID 102519384) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate.
| Compound Name | but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
|---|---|
| PubChem CID | 102519384 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
| SMILES | C=CCCOC(=O)/C(=N\c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-3-4-9-21-13(19)12(14(15,16)17)18-10-5-7-11(20-2)8-6-10/h3,5-8H,1,4,9H2,2H3/b18-12+ |
| InChIKey | UHIGFWOWZLTTJN-LDADJPATSA-N |
| XLogP | 3.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|