About but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate
but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate (PubChem CID 102519384) has the molecular formula C14H14F3NO3
and a molecular weight of 301.26 g/mol. Its IUPAC name is but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate.
Molecular Properties
| Compound Name | but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
| PubChem CID | 102519384 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
| SMILES | C=CCCOC(=O)/C(=N\c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-3-4-9-21-13(19)12(14(15,16)17)18-10-5-7-11(20-2)8-6-10/h3,5-8H,1,4,9H2,2H3/b18-12+ |
| InChIKey | UHIGFWOWZLTTJN-LDADJPATSA-N |
| XLogP | 3.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate?
The IUPAC name of but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate (CID 102519384) is but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate.
What is the SMILES notation for but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate?
The canonical SMILES for but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate is C=CCCOC(=O)/C(=N\c1ccc(OC)cc1)C(F)(F)F.
What is the InChIKey of but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate?
The InChIKey is UHIGFWOWZLTTJN-LDADJPATSA-N. The full InChI is InChI=1S/C14H14F3NO3/c1-3-4-9-21-13(19)12(14(15,16)17)18-10-5-7-11(20-2)8-6-10/h3,5-8H,1,4,9H2,2H3/b18-12+.
What are the key properties of but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate?
but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate has a molecular weight of 301.26 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate is sourced from PubChem (CID 102519384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).