C16H18F3NO3 — CID 135079006
[(Z)-6-oxohept-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate (PubChem CID 135079006) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is [(Z)-6-oxohept-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate.
| Compound Name | [(Z)-6-oxohept-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate |
|---|---|
| PubChem CID | 135079006 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(Z)-6-oxohept-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate |
| SMILES | COc1ccc(/N=C(\OC/C=C\CCC(C)=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3NO3/c1-12(21)6-4-3-5-11-23-15(16(17,18)19)20-13-7-9-14(22-2)10-8-13/h3,5,7-10H,4,6,11H2,1-2H3/b5-3-,20-15- |
| InChIKey | UMWCRKMGKZYDIP-PVHAKAMPSA-N |
| XLogP | 4.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|