C10H12ClNO3 — CID 14787850
2-(4-chlorophenyl)-N,2-dihydroxy-N-methylpropanamide (PubChem CID 14787850) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,2-dihydroxy-N-methylpropanamide.
| Compound Name | 2-(4-chlorophenyl)-N,2-dihydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 14787850 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N,2-dihydroxy-N-methylpropanamide |
| SMILES | CN(O)C(=O)C(C)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO3/c1-10(14,9(13)12(2)15)7-3-5-8(11)6-4-7/h3-6,14-15H,1-2H3 |
| InChIKey | OUEDHMTUFHEECB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|