C17H17F3N2O2 — CID 147733152
(2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-phenylethyl)propan-2-amine (PubChem CID 147733152) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-phenylethyl)propan-2-amine.
| Compound Name | (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-phenylethyl)propan-2-amine |
|---|---|
| PubChem CID | 147733152 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-phenylethyl)propan-2-amine |
| SMILES | O=[N+]([O-])C[C@](NCCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O2/c18-17(19,20)16(13-22(23)24,15-9-5-2-6-10-15)21-12-11-14-7-3-1-4-8-14/h1-10,21H,11-13H2/t16-/m0/s1 |
| InChIKey | GYVJJFZCSZKPLJ-INIZCTEOSA-N |
| XLogP | 3.55 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|