C10H8F3NO — CID 166099883
4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol (PubChem CID 166099883) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol.
| Compound Name | 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 166099883 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
| SMILES | NC#CC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)9(15,6-7-14)8-4-2-1-3-5-8/h1-5,15H,14H2 |
| InChIKey | NQVGGLICQAJAHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|