About 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol
4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol (PubChem CID 166099883) has the molecular formula C10H8F3NO
and a molecular weight of 215.17 g/mol. Its IUPAC name is 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
| PubChem CID | 166099883 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
| SMILES | NC#CC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)9(15,6-7-14)8-4-2-1-3-5-8/h1-5,15H,14H2 |
| InChIKey | NQVGGLICQAJAHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol?
The IUPAC name of 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol (CID 166099883) is 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol.
What is the SMILES notation for 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol?
The canonical SMILES for 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol is NC#CC(O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol?
The InChIKey is NQVGGLICQAJAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO/c11-10(12,13)9(15,6-7-14)8-4-2-1-3-5-8/h1-5,15H,14H2.
What are the key properties of 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol?
4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol has a molecular weight of 215.17 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol is sourced from PubChem (CID 166099883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).