About (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate
(4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate (PubChem CID 175471707) has the molecular formula C16H13NO5
and a molecular weight of 299.28 g/mol. Its IUPAC name is (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 175471707 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13NO5/c18-16(11-6-13-4-2-1-3-5-13)22-12-21-15-9-7-14(8-10-15)17(19)20/h1-11H,12H2/b11-6+ |
| InChIKey | SXCSVTSFHKWRAD-IZZDOVSWSA-N |
| XLogP | 3.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate?
The IUPAC name of (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate (CID 175471707) is (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)OCOc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate?
The InChIKey is SXCSVTSFHKWRAD-IZZDOVSWSA-N. The full InChI is InChI=1S/C16H13NO5/c18-16(11-6-13-4-2-1-3-5-13)22-12-21-15-9-7-14(8-10-15)17(19)20/h1-11H,12H2/b11-6+.
What are the key properties of (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate?
(4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate has a molecular weight of 299.28 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenoxy)methyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 175471707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).