C12H14F9NO4S — CID 58855074
2-[methyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]ethyl prop-2-enoate (PubChem CID 58855074) has the molecular formula C12H14F9NO4S and a molecular weight of 439.30 g/mol. Its IUPAC name is 2-[methyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]ethyl prop-2-enoate.
| Compound Name | 2-[methyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58855074 |
| Molecular Formula | C12H14F9NO4S |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-[methyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)S(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F9NO4S/c1-3-8(23)26-6-5-22(2)27(24,25)7-4-9(13,14)10(15,16)11(17,18)12(19,20)21/h3H,1,4-7H2,2H3 |
| InChIKey | HGKQBLOWECOSMR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|