C22H28F6O6 — CID 118906641
[1,1,2,2,3,3-hexafluoro-4-[2-(2-methylbutanoyloxy)ethoxy]-4-oxobutyl] adamantane-1-carboxylate (PubChem CID 118906641) has the molecular formula C22H28F6O6 and a molecular weight of 502.45 g/mol. Its IUPAC name is [1,1,2,2,3,3-hexafluoro-4-[2-(2-methylbutanoyloxy)ethoxy]-4-oxobutyl] adamantane-1-carboxylate.
| Compound Name | [1,1,2,2,3,3-hexafluoro-4-[2-(2-methylbutanoyloxy)ethoxy]-4-oxobutyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 118906641 |
| Molecular Formula | C22H28F6O6 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [1,1,2,2,3,3-hexafluoro-4-[2-(2-methylbutanoyloxy)ethoxy]-4-oxobutyl] adamantane-1-carboxylate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)C(F)(F)OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28F6O6/c1-3-12(2)16(29)32-4-5-33-18(31)20(23,24)21(25,26)22(27,28)34-17(30)19-9-13-6-14(10-19)8-15(7-13)11-19/h12-15H,3-11H2,1-2H3 |
| InChIKey | ILQHVPZCWUTVLF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|