C15H25NO2 — CID 113402760
N-[(2R)-1-hydroxypropan-2-yl]-3-methyladamantane-1-carboxamide (PubChem CID 113402760) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2R)-1-hydroxypropan-2-yl]-3-methyladamantane-1-carboxamide.
| Compound Name | N-[(2R)-1-hydroxypropan-2-yl]-3-methyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 113402760 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-[(2R)-1-hydroxypropan-2-yl]-3-methyladamantane-1-carboxamide |
| SMILES | C[C@H](CO)NC(=O)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C15H25NO2/c1-10(8-17)16-13(18)15-6-11-3-12(7-15)5-14(2,4-11)9-15/h10-12,17H,3-9H2,1-2H3,(H,16,18)/t10-,11?,12?,14?,15?/m1/s1 |
| InChIKey | IHSLVKFLHIUAOT-NAJBLILTSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |