C25H48N6O7 — CID 175363738
N-(5-acetamidopentyl)-N'-[5-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide (PubChem CID 175363738) has the molecular formula C25H48N6O7 and a molecular weight of 544.69 g/mol. Its IUPAC name is N-(5-acetamidopentyl)-N'-[5-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide.
| Compound Name | N-(5-acetamidopentyl)-N'-[5-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 175363738 |
| Molecular Formula | C25H48N6O7 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | N-(5-acetamidopentyl)-N'-[5-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
| SMILES | CC(=O)NCCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN |
| InChI | InChI=1S/C25H48N6O7/c1-21(32)27-16-6-3-7-17-28-22(33)11-14-25(36)31(38)20-10-4-8-18-29-23(34)12-13-24(35)30(37)19-9-2-5-15-26/h37-38H,2-20,26H2,1H3,(H,27,32)(H,28,33)(H,29,34) |
| InChIKey | PEMWVGRCDATOPI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|