C31H52N6O8 — CID 146682101
N'-(5-aminopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide (PubChem CID 146682101) has the molecular formula C31H52N6O8 and a molecular weight of 636.79 g/mol. Its IUPAC name is N'-(5-aminopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide.
| Compound Name | N'-(5-aminopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 146682101 |
| Molecular Formula | C31H52N6O8 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | N'-(5-aminopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
| SMILES | NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C31H52N6O8/c32-19-7-2-10-22-35(43)29(40)17-15-27(38)33-20-8-3-11-23-36(44)30(41)18-16-28(39)34-21-9-4-12-24-37(45)31(42)25-26-13-5-1-6-14-26/h1,5-6,13-14,43-45H,2-4,7-12,15-25,32H2,(H,33,38)(H,34,39) |
| InChIKey | YVYARPMNFXTRBD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 205.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|