C17H31FN4O6 — CID 163108984
4-[[4-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-3-fluorobutyl]amino]-4-oxobutanoic acid (PubChem CID 163108984) has the molecular formula C17H31FN4O6 and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[[4-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-3-fluorobutyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-3-fluorobutyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163108984 |
| Molecular Formula | C17H31FN4O6 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4-[[4-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-3-fluorobutyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCCN(O)C(=O)CCC(=O)NCC(F)CCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C17H31FN4O6/c18-13(8-10-20-14(23)5-7-17(26)27)12-21-15(24)4-6-16(25)22(28)11-3-1-2-9-19/h13,28H,1-12,19H2,(H,20,23)(H,21,24)(H,26,27) |
| InChIKey | GJZLRSJDAUQRJQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|