C30H56N4O8 — CID 163181898
4-[5-[hydroxy-[4-[5-[hydroxy(10-methylundecanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentylamino]-4-oxobutanoic acid (PubChem CID 163181898) has the molecular formula C30H56N4O8 and a molecular weight of 600.80 g/mol. Its IUPAC name is 4-[5-[hydroxy-[4-[5-[hydroxy(10-methylundecanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentylamino]-4-oxobutanoic acid.
| Compound Name | 4-[5-[hydroxy-[4-[5-[hydroxy(10-methylundecanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163181898 |
| Molecular Formula | C30H56N4O8 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | 4-[5-[hydroxy-[4-[5-[hydroxy(10-methylundecanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentylamino]-4-oxobutanoic acid |
| SMILES | CC(C)CCCCCCCCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C30H56N4O8/c1-25(2)15-9-5-3-4-6-10-16-28(37)33(41)23-13-7-11-21-31-26(35)17-19-29(38)34(42)24-14-8-12-22-32-27(36)18-20-30(39)40/h25,41-42H,3-24H2,1-2H3,(H,31,35)(H,32,36)(H,39,40) |
| InChIKey | ZKYSAJOWEPQAFE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|