C16H28F2N4O7 — CID 163109056
4-[[4-[[4-[(4-amino-3-fluorobutyl)-hydroxyamino]-4-oxobutanoyl]amino]-3-fluorobutyl]-hydroxyamino]-4-oxobutanoic acid (PubChem CID 163109056) has the molecular formula C16H28F2N4O7 and a molecular weight of 426.42 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-amino-3-fluorobutyl)-hydroxyamino]-4-oxobutanoyl]amino]-3-fluorobutyl]-hydroxyamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[[4-[(4-amino-3-fluorobutyl)-hydroxyamino]-4-oxobutanoyl]amino]-3-fluorobutyl]-hydroxyamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163109056 |
| Molecular Formula | C16H28F2N4O7 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-[[4-[[4-[(4-amino-3-fluorobutyl)-hydroxyamino]-4-oxobutanoyl]amino]-3-fluorobutyl]-hydroxyamino]-4-oxobutanoic acid |
| SMILES | NCC(F)CCN(O)C(=O)CCC(=O)NCC(F)CCN(O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C16H28F2N4O7/c17-11(9-19)5-7-21(28)14(24)2-1-13(23)20-10-12(18)6-8-22(29)15(25)3-4-16(26)27/h11-12,28-29H,1-10,19H2,(H,20,23)(H,26,27) |
| InChIKey | GODKZLVWLHWAIC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|