C32H52N6O9 — CID 154585454
N'-(5-formamidopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide (PubChem CID 154585454) has the molecular formula C32H52N6O9 and a molecular weight of 664.80 g/mol. Its IUPAC name is N'-(5-formamidopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide.
| Compound Name | N'-(5-formamidopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 154585454 |
| Molecular Formula | C32H52N6O9 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | N'-(5-formamidopentyl)-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy-(2-phenylacetyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
| SMILES | O=CNCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H52N6O9/c39-26-33-19-7-2-10-22-36(45)30(42)17-15-28(40)34-20-8-3-11-23-37(46)31(43)18-16-29(41)35-21-9-4-12-24-38(47)32(44)25-27-13-5-1-6-14-27/h1,5-6,13-14,26,45-47H,2-4,7-12,15-25H2,(H,33,39)(H,34,40)(H,35,41) |
| InChIKey | KOMLUWJPVZPVEC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|