C12H22N2O4 — CID 145020426
N-[5-[hydroxy(propanoyl)amino]pentyl]-4-oxobutanamide (PubChem CID 145020426) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[5-[hydroxy(propanoyl)amino]pentyl]-4-oxobutanamide.
| Compound Name | N-[5-[hydroxy(propanoyl)amino]pentyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 145020426 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N-[5-[hydroxy(propanoyl)amino]pentyl]-4-oxobutanamide |
| SMILES | CCC(=O)N(O)CCCCCNC(=O)CCC=O |
| InChI | InChI=1S/C12H22N2O4/c1-2-12(17)14(18)9-5-3-4-8-13-11(16)7-6-10-15/h10,18H,2-9H2,1H3,(H,13,16) |
| InChIKey | DUORIMWOHCLTTM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|