C39H57N7O9 — CID 122214470
N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[(2-carbazol-9-ylacetyl)amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide (PubChem CID 122214470) has the molecular formula C39H57N7O9 and a molecular weight of 767.92 g/mol. Its IUPAC name is N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[(2-carbazol-9-ylacetyl)amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide.
| Compound Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[(2-carbazol-9-ylacetyl)amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 122214470 |
| Molecular Formula | C39H57N7O9 |
| Molecular Weight | 767.92 g/mol |
| Exact Mass | 767.42 |
| IUPAC Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[(2-carbazol-9-ylacetyl)amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C39H57N7O9/c1-30(47)44(53)26-12-2-9-23-40-35(48)19-21-38(51)45(54)27-13-3-10-24-41-36(49)20-22-39(52)46(55)28-14-4-11-25-42-37(50)29-43-33-17-7-5-15-31(33)32-16-6-8-18-34(32)43/h5-8,15-18,53-55H,2-4,9-14,19-29H2,1H3,(H,40,48)(H,41,49)(H,42,50) |
| InChIKey | QDNRLYLSNSRMTJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 213.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|