C25H48N6O8 — CID 87396043
N-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentoxy)butanediamide (PubChem CID 87396043) has the molecular formula C25H48N6O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is N-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentoxy)butanediamide.
| Compound Name | N-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentoxy)butanediamide |
|---|---|
| PubChem CID | 87396043 |
| Molecular Formula | C25H48N6O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | N-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentoxy)butanediamide |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)NOCCCCCN |
| InChI | InChI=1S/C25H48N6O8/c1-21(32)30(37)18-8-3-6-17-28-23(34)13-14-25(36)31(38)19-9-4-7-16-27-22(33)11-12-24(35)29-39-20-10-2-5-15-26/h37-38H,2-20,26H2,1H3,(H,27,33)(H,28,34)(H,29,35) |
| InChIKey | FAVOZJDEYMZENY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 203.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|