C21H34ClN5O5 — CID 19883625
benzyl 3-[[4-[6-(diaminomethylideneamino)hexanoylamino]-3-hydroxybutanoyl]amino]propanoate;hydrochloride (PubChem CID 19883625) has the molecular formula C21H34ClN5O5 and a molecular weight of 471.99 g/mol. Its IUPAC name is benzyl 3-[[4-[6-(diaminomethylideneamino)hexanoylamino]-3-hydroxybutanoyl]amino]propanoate;hydrochloride.
| Compound Name | benzyl 3-[[4-[6-(diaminomethylideneamino)hexanoylamino]-3-hydroxybutanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 19883625 |
| Molecular Formula | C21H34ClN5O5 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | benzyl 3-[[4-[6-(diaminomethylideneamino)hexanoylamino]-3-hydroxybutanoyl]amino]propanoate;hydrochloride |
| SMILES | Cl.NC(N)=NCCCCCC(=O)NCC(O)CC(=O)NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H33N5O5.ClH/c22-21(23)25-11-6-2-5-9-18(28)26-14-17(27)13-19(29)24-12-10-20(30)31-15-16-7-3-1-4-8-16;/h1,3-4,7-8,17,27H,2,5-6,9-15H2,(H,24,29)(H,26,28)(H4,22,23,25);1H |
| InChIKey | SPRITLVCUOKKGP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|