C35H56ClN7O6 — CID 70399223
benzyl N-[4-[[2-amino-11-(diaminomethylideneamino)-1-hydroxy-4-oxoundecyl]amino]butyl]-N-[3-(phenylmethoxycarbonylamino)propyl]carbamate;hydrochloride (PubChem CID 70399223) has the molecular formula C35H56ClN7O6 and a molecular weight of 706.33 g/mol. Its IUPAC name is benzyl N-[4-[[2-amino-11-(diaminomethylideneamino)-1-hydroxy-4-oxoundecyl]amino]butyl]-N-[3-(phenylmethoxycarbonylamino)propyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[4-[[2-amino-11-(diaminomethylideneamino)-1-hydroxy-4-oxoundecyl]amino]butyl]-N-[3-(phenylmethoxycarbonylamino)propyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70399223 |
| Molecular Formula | C35H56ClN7O6 |
| Molecular Weight | 706.33 g/mol |
| Exact Mass | 705.40 |
| IUPAC Name | benzyl N-[4-[[2-amino-11-(diaminomethylideneamino)-1-hydroxy-4-oxoundecyl]amino]butyl]-N-[3-(phenylmethoxycarbonylamino)propyl]carbamate;hydrochloride |
| SMILES | Cl.NC(N)=NCCCCCCCC(=O)CC(N)C(O)NCCCCN(CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H55N7O6.ClH/c36-31(25-30(43)19-10-2-1-3-11-21-40-33(37)38)32(44)39-20-12-13-23-42(35(46)48-27-29-17-8-5-9-18-29)24-14-22-41-34(45)47-26-28-15-6-4-7-16-28;/h4-9,15-18,31-32,39,44H,1-3,10-14,19-27,36H2,(H,41,45)(H4,37,38,40);1H |
| InChIKey | PZQKIFFFVXYERE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 207.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|