C18H30N4O5 — CID 135207371
benzyl N-(3-hydroxypropyl)carbamate;6-(diaminomethylideneamino)hexanoic acid (PubChem CID 135207371) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is benzyl N-(3-hydroxypropyl)carbamate;6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | benzyl N-(3-hydroxypropyl)carbamate;6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 135207371 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | benzyl N-(3-hydroxypropyl)carbamate;6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NC(N)=NCCCCCC(=O)O.O=C(NCCCO)OCc1ccccc1 |
| InChI | InChI=1S/C11H15NO3.C7H15N3O2/c13-8-4-7-12-11(14)15-9-10-5-2-1-3-6-10;8-7(9)10-5-3-1-2-4-6(11)12/h1-3,5-6,13H,4,7-9H2,(H,12,14);1-5H2,(H,11,12)(H4,8,9,10) |
| InChIKey | FCENPQKFFZTMDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|