C35H51N7O8 — CID 18598666
[(3S)-7-(diaminomethylideneamino)-1-oxo-1-[[2-oxo-2-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butylamino]ethyl]amino]heptan-3-yl] acetate (PubChem CID 18598666) has the molecular formula C35H51N7O8 and a molecular weight of 697.83 g/mol. Its IUPAC name is [(3S)-7-(diaminomethylideneamino)-1-oxo-1-[[2-oxo-2-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butylamino]ethyl]amino]heptan-3-yl] acetate.
| Compound Name | [(3S)-7-(diaminomethylideneamino)-1-oxo-1-[[2-oxo-2-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butylamino]ethyl]amino]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 18598666 |
| Molecular Formula | C35H51N7O8 |
| Molecular Weight | 697.83 g/mol |
| Exact Mass | 697.38 |
| IUPAC Name | [(3S)-7-(diaminomethylideneamino)-1-oxo-1-[[2-oxo-2-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butylamino]ethyl]amino]heptan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](CCCCN=C(N)N)CC(=O)NCC(=O)NCCCCN(CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H51N7O8/c1-27(43)50-30(17-8-9-19-39-33(36)37)23-31(44)41-24-32(45)38-18-10-11-21-42(35(47)49-26-29-15-6-3-7-16-29)22-12-20-40-34(46)48-25-28-13-4-2-5-14-28/h2-7,13-16,30H,8-12,17-26H2,1H3,(H,38,45)(H,40,46)(H,41,44)(H4,36,37,39)/t30-/m0/s1 |
| InChIKey | DLPDAFQKLOKDQT-PMERELPUSA-N |
| XLogP | 2.72 |
| TPSA | 216.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|