C12H18N3O3- — CID 163140404
(2R)-2-amino-N-[4-[hydroxy(oxido)amino]phenyl]-4-methylpentanamide (PubChem CID 163140404) has the molecular formula C12H18N3O3- and a molecular weight of 252.29 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-[hydroxy(oxido)amino]phenyl]-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-[4-[hydroxy(oxido)amino]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 163140404 |
| Molecular Formula | C12H18N3O3- |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R)-2-amino-N-[4-[hydroxy(oxido)amino]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C12H18N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11,17H,7,13H2,1-2H3,(H,14,16)/q-1/t11-/m1/s1 |
| InChIKey | MGSYWCNHLYZETI-LLVKDONJSA-N |
| XLogP | 1.69 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|