C19H29N3O5S2 — CID 55756704
3-cyclopentylsulfonyl-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide (PubChem CID 55756704) has the molecular formula C19H29N3O5S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 55756704 |
| Molecular Formula | C19H29N3O5S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=O)CCS(=O)(=O)C3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O5S2/c1-21-11-13-22(14-12-21)29(26,27)18-8-6-16(7-9-18)20-19(23)10-15-28(24,25)17-4-2-3-5-17/h6-9,17H,2-5,10-15H2,1H3,(H,20,23) |
| InChIKey | HGACNGMELKREFX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |