C18H17F3N2O2 — CID 110300090
N,N-dimethyl-4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]benzamide (PubChem CID 110300090) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]benzamide.
| Compound Name | N,N-dimethyl-4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]benzamide |
|---|---|
| PubChem CID | 110300090 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N,N-dimethyl-4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(CCC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H17F3N2O2/c1-23(2)18(25)12-6-3-11(4-7-12)5-10-15(24)22-14-9-8-13(19)16(20)17(14)21/h3-4,6-9H,5,10H2,1-2H3,(H,22,24) |
| InChIKey | GMCSKPPVRWOMRK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|