C22H23NO7 — CID 4785230
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (PubChem CID 4785230) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
|---|---|
| PubChem CID | 4785230 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CC(=O)c1ccc(OCCCC(=O)OCC(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H23NO7/c1-15(24)17-5-7-18(8-6-17)27-10-2-3-22(26)28-13-21(25)23-12-16-4-9-19-20(11-16)30-14-29-19/h4-9,11H,2-3,10,12-14H2,1H3,(H,23,25) |
| InChIKey | IWHBXESHLRAYJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|