C19H24N2O3 — CID 82153211
5-[3-(1,3-benzodioxol-5-ylmethylamino)propyl]-2-ethoxyaniline (PubChem CID 82153211) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-[3-(1,3-benzodioxol-5-ylmethylamino)propyl]-2-ethoxyaniline.
| Compound Name | 5-[3-(1,3-benzodioxol-5-ylmethylamino)propyl]-2-ethoxyaniline |
|---|---|
| PubChem CID | 82153211 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-[3-(1,3-benzodioxol-5-ylmethylamino)propyl]-2-ethoxyaniline |
| SMILES | CCOc1ccc(CCCNCc2ccc3c(c2)OCO3)cc1N |
| InChI | InChI=1S/C19H24N2O3/c1-2-22-17-7-5-14(10-16(17)20)4-3-9-21-12-15-6-8-18-19(11-15)24-13-23-18/h5-8,10-11,21H,2-4,9,12-13,20H2,1H3 |
| InChIKey | VTNGMMMNCIFOEP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|