C19H23NO2 — CID 171532334
3-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylbutan-2-amine (PubChem CID 171532334) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylbutan-2-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 171532334 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylbutan-2-amine |
| SMILES | CC(c1ccc2c(c1)OCO2)C(C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-14(17-9-10-18-19(11-17)22-13-21-18)15(2)20(3)12-16-7-5-4-6-8-16/h4-11,14-15H,12-13H2,1-3H3 |
| InChIKey | RWJDZVFNGTWUNZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |